Monoisobutyl phthalic acid-d4 [CAS 1219802-26-2]
Partner: MedChemexpress LLC
| CAS No: | 1219802-26-2 |
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 226.26 |
| Formula: | C12H10D4O4 |
| SMILES: | CC(C)COC(C1=C(C([2H])=C([2H])C([2H])=C1[2H])C(O)=O)=O |
| Purity: | 99.03 |
| Description: | Monoisobutyl phthalic acid-d4 is the deuterium labeled Monoisobutyl phthalic acid[1]. Monoisobutyl phthalic acid is a phthalate metabolite that is in human semen and in meconium[2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
