1-Methyladenosine [CAS 15763-06-1] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 15763-06-1 |
| MW: | 281.27 |
| Formula: | C11H15N5O4 |
| SMILES: | OC[C@@H]1[C@@H](O)[C@@H](O)[C@H](N2C(N=CN(C)C3=N)=C3N=C2)O1 |
| Purity: | 98.36 |
| Description: | 1-Methyladenosine is an RNA modification originating essentially from two different reaction types, one catalyzed by enzymes and the other the result of the reaction of RNA with certain alkylating agents. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
