N1-Acetylspermidine (hydrochloride) [CAS 34450-16-3]
Partner: MedChemexpress LLC
| CAS No: | 34450-16-3 |
| Applications: | Cancer-programmed cell death |
| MW: | 260.20 |
| Formula: | C9H23Cl2N3O |
| SMILES: | CC(NCCCNCCCCN)=O.[H]Cl.[H]Cl |
| Purity: | 99.0 |
| Description: | N1-Acetylspermidine hydrochloride is an acetyl derivative of polyamine. N1-acetylspermine is the substrate for the polyamine oxidase (PAO). N1-Acetylspermidine hydrochloride selectively elevates its level in human colorectal adenocarcinomas. N1-acetylspermidine shows cleavage efficiency at apurinic sites in DNA[1][2][3]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
