PTZ-343 [CAS 101199-38-6]
Partner: MedChemexpress LLC
| CAS No: | 101199-38-6 |
| Applications: | Cancer-programmed cell death |
| MW: | 343.40 |
| Formula: | C15H14NNaO3S2 |
| SMILES: | O=S(CCCN1C2=C(C=CC=C2)SC3=CC=CC=C13)(O[Na])=O |
| Purity: | 99.97 |
| Description: | PTZ-343 is a potent enhancer of Luminol (HY-15922). PTZ-343 greatly increases the light output of the peroxidase-catalyzed luminol chemiluminescent oxidation reaction (>80%)[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
