(+)-JQ1 PA [CAS 2115701-93-2]
Partner: MedChemexpress LLC
| CAS No: | 2115701-93-2 |
| Applications: | Cancer-programmed cell death |
| MW: | 437.95 |
| Formula: | C22H20ClN5OS |
| SMILES: | O=C(NCC#C)C[C@H]1C2=NN=C(C)N2C3=C(C(C)=C(C)S3)C(C4=CC=C(Cl)C=C4)=N1 |
| Purity: | 98.87 |
| Description: | (+)-JQ1 PA is a derivative of the Bromodomain and extra-terminal (BET) inhibitor JQ1, with an IC50 of 10.4 nM. (+)-JQ1 PA is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
