N1-Methylpseudouridine [CAS 13860-38-3]
Partner: MedChemexpress LLC
| CAS No: | 13860-38-3 |
| Applications: | COVID-19-immunoregulation |
| MW: | 258.23 |
| Formula: | C10H14N2O6 |
| SMILES: | OC[C@@H]1[C@@H](O)[C@@H](O)[C@H](C(C(N2)=O)=CN(C)C2=O)O1 |
| Purity: | 99.92 |
| Description: | N1-methyl-pseudouridine (1-Methylpseudouridine), a methylpseudouridine, outperforms 5 mC and 5 mC/N1-methyl-pseudouridine in translation. N1-methyl-pseudouridine in mRNA enhances translation through eIF2?-dependent and independent mechanisms by increasing ribosome density[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
