RR-11a analog [CAS 685543-66-2]
Partner: MedChemexpress LLC
| CAS No: | 685543-66-2 |
| Applications: | COVID-19-immunoregulation |
| MW: | 491.49 |
| Formula: | C22H29N5O8 |
| SMILES: | O=C(N[C@@H](C)C(N[C@@H](C)C(NN(CC(N)=O)C(/C=C/C(OCC)=O)=O)=O)=O)OCC1=CC=CC=C1 |
| Purity: | 99.12 |
| Description: | RR-11a analog is a potent and irreversible inhibitor of Schistosoma mansoni legumain, with an IC50 of 31 nM. RR-11a analog is an aza-Asn derivative and aza-peptide Michael acceptor[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
