PROTAC ERAlpha Degrader-1 [CAS 2417369-94-7]
Partner: MedChemexpress LLC
| CAS No: | 2417369-94-7 |
| Applications: | Cancer-programmed cell death |
| MW: | 1120.29 |
| Formula: | C66H69N7O10 |
| SMILES: | OC1=CC=C(/C(C2=CC=C(OCCN(C)C(COCCOCCNC(C3=CC=C(C(N4[C@@H](C)[C@H](NC([C@H](C)NC)=O)C(N(CC5=C(OC)C=CC6=C5C=CC=C6)C7=C4C=C(C#N)C=C7)=O)=O)C=C3)=O)=O)C=C2)=C(C8=CC=CC=C8)\CC)C=C1 |
| Purity: | 99.59 |
| Description: | PROTAC ER? Degrader-1 comprises an ubiquitin E3 ligase binding group, a linker and a protein binding group. PROTAC ER? Degrader-1 extracts from patent WO2017201449A1, compound P1. PROTAC ER? Degrader-1 is an estrogen receptor-alpha (ER?) degrader. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
