(+)-Erinacin A [CAS 156101-08-5]
Partner: MedChemexpress LLC
| CAS No: | 156101-08-5 |
| Applications: | Cancer-programmed cell death |
| MW: | 432.55 |
| Formula: | C25H36O6 |
| SMILES: | O[C@H]1[C@H](O)[C@@H](O)[C@H](O[C@@H]2[C@@](CC[C@]3(C)C4=C(C(C)C)CC3)(C)C4=CC=C(C=O)C2)OC1 |
| Purity: | 99.97 |
| Description: | (+)-Erinacin A is an anticancer compound that can be isolated from the mushroom Hericium erinaceum. (+)-Erinacin A has the capacity to trigger cancer cell death dependent on the production of reactive oxygen species (ROS). (+)-Erinacin A has anticancer and neuroprotective activity[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
