6-O-Methyl Guanosine [CAS 7803-88-5] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 7803-88-5 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 297.27 |
| Formula: | C11H15N5O5 |
| SMILES: | OC[C@@H]1[C@@H](O)[C@@H](O)[C@H](N(C=N2)C3=C2C(OC)=NC(N)=N3)O1 |
| Purity: | 98.62 |
| Description: | 6-O-Methyl Guanosine is a modified nucleoside[1]. 6-O-Methyl Guanosine (6-methylguanosine) inhibit colony-forming ability in a malignant xeroderma pigmentosum cell line[2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
