3'-Azido-3'-deoxy-Beta-L-uridine [CAS 2095417-28-8]
Partner: MedChemexpress LLC
CAS No: | 2095417-28-8 |
Applications: | Neuroscience-Neuromodulation |
MW: | 269.21 |
Formula: | C9H11N5O5 |
SMILES: | O[C@H]1[C@@H](N=[N+]=[N-])[C@H](CO)O[C@@H]1N2C=CC(NC2=O)=O |
Purity: | 98.77 |
Description: | 3'-Azido-3'-deoxy-beta-L-uridine (Compound 25) is a nucleoside derivative. 3'-Azido-3'-deoxy-beta-L-uridine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups. |
Shipping Conditions: | Ship at ambient |
Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice