3'-Azido-3'-deoxy-5-fluorocytidine [CAS 2095417-18-6] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 2095417-18-6 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 286.22 |
| Formula: | C9H11FN6O4 |
| SMILES: | O[C@@H]1[C@H](N=[N+]=[N-])[C@@H](CO)O[C@H]1N2C=C(F)C(N)=NC2=O |
| Purity: | 99.90 |
| Description: | 3'-Azido-3'-deoxy-5-fluorocytidine (Compound 12) is a cytidine derivative. 3'-Azido-3'-deoxy-5-fluorocytidine is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
