Sulfo-NHS-SS-Biotin (sodium) [CAS 325143-98-4]
Partner: MedChemexpress LLC
| CAS No: | 325143-98-4 |
| MW: | 606.69 |
| Formula: | C19H27N4NaO9S4 |
| SMILES: | O=C(ON1C(C(S(=O)(O[Na])=O)CC1=O)=O)CCSSCCNC(CCCC[C@@H]2SC[C@]([C@]2([H])N3)([H])NC3=O)=O |
| Purity: | 97.0 |
| Description: | Sulfo-NHS-SS-biotin is a long-chain cleavable and cell-impermeant amine-reactive biotinylation reagent. Sulfo-NHS-SS-biotin can be used for the labeling and purifying of cell-surface protein[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
