YAP/TAZ inhibitor-1 [CAS 2093565-23-0]
Partner: MedChemexpress LLC
| CAS No: | 2093565-23-0 |
| Applications: | Cancer-programmed cell death |
| MW: | 621.81 |
| Formula: | C33H39N3O5S2 |
| SMILES: | O=S(C1=CC2=C(C=C1)C3=C(C=C(S(=O)(C4CCC(C)(C)CC4)=O)C=C3)/C2=N\O)(N5CCN(C(C6=CC=CC=C6)C)CC5)=O |
| Purity: | 99.72 |
| Description: | YAP/TAZ inhibitor-1 is a YAP/TAZ inhibitor extracted from patent WO2017058716A1, Compound 1, has an IC50 of <0.100 ?? in firefly luciferase assay[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
