RO-9187 [CAS 876708-03-1]
Partner: MedChemexpress LLC
| CAS No: | 876708-03-1 |
| Applications: | COVID-19-anti-virus |
| MW: | 284.23 |
| Formula: | C9H12N6O5 |
| SMILES: | O=C1N=C(N)C=CN1[C@H]2[C@@H](O)[C@H](O)[C@](CO)(N=[N+]=[N-])O2 |
| Purity: | 98.39 |
| Description: | RO-9187 is a potent inhibitor of HCV virus replication with an IC50 of 171 nM. RO-9187 is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
