MRS2500 (tetraammonium) [CAS 630103-23-0]
Partner: MedChemexpress LLC
| CAS No: | 630103-23-0 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 629.28 |
| Formula: | C13H30IN9O8P2 |
| SMILES: | O=P(O[C@@H]1[C@]2(COP(O[NH4])(O[NH4])=O)C[C@]2([H])[C@@H](N3C=NC4=C(NC)N=C(I)N=C34)C1)(O[NH4])O[NH4] |
| Purity: | 99.85 |
| Description: | MRS2500 tetraammonium is a potent, selective and stable antagonist of the P2Y1 receptor (Ki=0.78 nM for recombinant human P2Y1 receptor). MRS2500 tetraammonium inhibits the ADP-induced aggregation of human platelets with an IC50 value of 0.95 nM. Antithrombotic activity[1][2][3]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
