AL 8697 [CAS 1057394-06-5] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 1057394-06-5 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 402.41 |
| Formula: | C21H21F3N4O |
| SMILES: | O=C(NC1CC1)C2=CC(F)=C(C)C(C3=C(F)C4=NN=C(C(C)(C)C)N4C=C3F)=C2 |
| Purity: | 99.83 |
| Description: | AL 8697 is a specific and orally active p38? MAPK inhibitor with an IC50 of 6 nM. AL 8697 displays 14-fold greater inhibition of p38? compared to p38? (IC50=82 nM), and 300-fold selectivity for p38? over a panel of 91 kinases. Anti-inflammatory activity[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
