Shz-1 [CAS 326886-05-9]
Partner: MedChemexpress LLC
| CAS No: | 326886-05-9 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 355.21 |
| Formula: | C13H11BrN2O3S |
| SMILES: | O=S(C1=CC=CC=C1)(N/N=C/C2=CC(Br)=CC=C2O)=O |
| Purity: | 99.88 |
| Description: | Shz-1, a small cardiogenic molecule, induces various cardiac-specific genes including sarcomeric tropomyosin in P19CL6 cells. Shz-1 induces Nkx2.5 expression in mouse. Shz-1 activates the axolotl TPM4 promoter-driven ectopic expression in C2C12 cells[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
