TCS 46b [CAS 302799-86-6]
Partner: MedChemexpress LLC
| CAS No: | 302799-86-6 |
| Applications: | Neuroscience-Neurodegeneration |
| MW: | 345.44 |
| Formula: | C22H23N3O |
| SMILES: | O=C1NC2=CC=C(C=C2N1)C#CCN3CCC(CC3)CC4=CC=CC=C4 |
| Purity: | 99.84 |
| Description: | TCS 46b (Compound 46b) is a potent, selective and orally active NMDA NR1A/2B receptor antagonist with an IC50 of 5.3 nM[1]. TCS 46b is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
