AEG3482 [CAS 63735-71-7]
Partner: MedChemexpress LLC
| CAS No: | 63735-71-7 |
| Applications: | Neuroscience-Neurodegeneration |
| MW: | 280.33 |
| Formula: | C10H8N4O2S2 |
| SMILES: | O=S(C1=NN2C(S1)=NC(C3=CC=CC=C3)=C2)(N)=O |
| Purity: | 99.95 |
| Description: | AEG3482 is a potent antiapoptotic compound that inhibits Jun kinase (JNK) activity through induced expression of heat shock protein 70 (HSP70). AEG3482 directly binds HSP90, thereby facilitating HSF1-dependent expression of HSP70 and HSP25[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
