SC-26196 [CAS 218136-59-5]
Partner: MedChemexpress LLC
| CAS No: | 218136-59-5 |
| Applications: | COVID-19-immunoregulation |
| MW: | 423.55 |
| Formula: | C27H29N5 |
| SMILES: | N#CC(C1=CC=CC=C1)(C2=CC=CC=C2)CCCN3CCN(/N=C/C4=CC=CN=C4)CC3 |
| Purity: | 99.68 |
| Description: | SC-26196 is a potent, orally active Delta6 desaturase (D6D, FADS2) inhibitor (IC50=0.2 �M in a rat liver microsomal assay). Antiinflammatory properties[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
