(+)-EMD 57033 [CAS 147527-31-9]
Partner: MedChemexpress LLC
| CAS No: | 147527-31-9 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 425.50 |
| Formula: | C22H23N3O4S |
| SMILES: | O=C(N1CCCC2=C1C=CC(C3=NNC(SC3C)=O)=C2)C4=CC=C(OC)C(OC)=C4 |
| Description: | (+)-EMD 57033 is a cardiac troponin C (cTnC) activator, is a dominant Ca2+ sensitizer. (+)-EMD 57033 binds the cardiac/slow skeletal troponin C isoform and exerts myocardial contractile promotion function[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
