Andolast (free base) [CAS 132640-22-3]
Partner: MedChemexpress LLC
| CAS No: | 132640-22-3 |
| Applications: | COVID-19-immunoregulation |
| MW: | 333.31 |
| Formula: | C15H11N9O |
| SMILES: | O=C(C1=CC=C(C2=NN=NN2)C=C1)NC3=CC=C(C4=NN=NN4)C=C3 |
| Purity: | 98.09 |
| Description: | Andolast (CR 2039) (free base) is an anti-allergic agent. Andolast can inhibit cAMP-phosphodiesterase with an IC50 value of 50 ?M. Andolast can be used for the research of asthma[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
