MMV390048 [CAS 1314883-11-8] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 1314883-11-8 |
| Applications: | COVID-19-immunoregulation |
| MW: | 393.38 |
| Formula: | C18H14F3N3O2S |
| SMILES: | NC1=NC=C(C2=CC=C(S(=O)(C)=O)C=C2)C=C1C3=CC=C(C(F)(F)F)N=C3 |
| Purity: | 99.17 |
| Description: | MMV390048 is a representative of a new chemical class of Plasmodium PI4K inhibitor (Kdapp=0.3 �M). MMV390048 binds to the ATP binding site of Plasmodium PI4K and does not bind to other P. falciparum and human kinases apart from human PIP4K2C, thus alleviating potential kinase-mediated safety concerns. MMV390048 is an antimalarial agent[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
