Delavirdine (mesylate) [CAS 147221-93-0]
Partner: MedChemexpress LLC
| CAS No: | 147221-93-0 |
| Applications: | COVID-19-anti-virus |
| MW: | 552.67 |
| Formula: | C23H32N6O6S2 |
| SMILES: | O=S(NC1=CC=C(NC(C(N2CCN(C3=C(NC(C)C)C=CC=N3)CC2)=O)=C4)C4=C1)(C)=O.O=S(O)(C)=O |
| Purity: | 99.82 |
| Description: | Delavirdine (U 90152) mesylate is a potent, highly specific and orally active non-nucleoside reverse transcriptase inhibitor (NNRTI). Delavirdine mesylate selectively inhibits HIV-1 reverse transcriptase (RT) (IC50=0.26�?M) over DNA polymerase�?�(IC50=440 ?M) and polymerase�? (IC50>550�?M). Delavirdine mesylate is an inhibitor of HIV-1 replication and can can be used for the study of AIDs[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
