Azidamfenicol [CAS 13838-08-9]
Partner: MedChemexpress LLC
| CAS No: | 13838-08-9 |
| Applications: | COVID-19-immunoregulation |
| MW: | 295.25 |
| Formula: | C11H13N5O5 |
| SMILES: | O=C(N[C@H](CO)[C@H](O)C1=CC=C([N+]([O-])=O)C=C1)CN=[N+]=[N-] |
| Description: | Azidamfenicol is a broad-spectrum chloramphenicol-like antibiotic. Azidamfenicol inhibits ribosomal peptidyltransferase (Ki=22 ?M)[1]. Azidamfenicol is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. Strain-promoted alkyne-azide cycloaddition (SPAAC) can also occur with molecules containing DBCO or BCN groups. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
