Orteronel [CAS 566939-85-3]
Partner: MedChemexpress LLC
| CAS No: | 566939-85-3 |
| Applications: | Cancer-programmed cell death |
| MW: | 307.35 |
| Formula: | C18H17N3O2 |
| SMILES: | O=C(C1=CC=C2C=C([C@@]3(O)CCN4C=NC=C43)C=CC2=C1)NC |
| Purity: | 99.70 |
| Description: | Orteronel (TAK-700) is a highly selective�inhibitor of human�17,20-lyase (CYP17) with�IC50�of 38 nM, and exhibits >1000-fold selectivity over other CYPs such as 11-hydroxylase and CYP3A4[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
