(�)-Enitociclib [CAS 1610358-53-6] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 1610358-53-6 |
| Applications: | Cancer-Kinase/protease |
| MW: | 404.43 |
| Formula: | C19H18F2N4O2S |
| SMILES: | N=S(CC1=CC(NC2=NC=C(F)C(C3=CC=C(F)C=C3OC)=C2)=NC=C1)(C)=O |
| Purity: | 99.87 |
| Description: | (�)-Enitociclib ((�)-BAY-1251152) is a racemic mixture of BAY-1251152. BAY-1251152 is a potent and highly selective PTEF/CDK9 inhibitor. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
