AKT Kinase Inhibitor (hydrochloride)
Partner: MedChemexpress LLC
| Applications: | Cancer-Kinase/protease |
| MW: | 393.83 |
| Formula: | C16H20ClN7O3 |
| SMILES: | OCC#CC1=NC=C(C2=C1N=C(N2CC)C3=NON=C3N)OCCCN.[H]Cl |
| Purity: | 99.18 |
| Description: | AKT Kinase Inhibitor hydrochloride is an Akt kinase inhibitor with anti-tumor activity[1]. AKT Kinase Inhibitor (hydrochloride) is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
