Tomaymycin DM [CAS 945490-09-5]
Partner: MedChemexpress LLC
| CAS No: | 945490-09-5 |
| Applications: | Cancer-programmed cell death |
| MW: | 258.27 |
| Formula: | C14H14N2O3 |
| SMILES: | O=C1N2[C@](CC(C2)=C)([H])C=NC3=CC(O)=C(OC)C=C13 |
| Purity: | 98.01 |
| Description: | Tomaymycin DM, a DNA alkylator, is a derivative of Tomaymycin, it is a PBD dimer, which is attached to tumor targeting antibodies to create antibody-drug conjugates (ADCs). |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
