Oxotremorine M (iodide) [CAS 3854-04-4]
Partner: MedChemexpress LLC
| CAS No: | 3854-04-4 |
| Applications: | Neuroscience-Neurodegeneration |
| MW: | 322.19 |
| Formula: | C11H19IN2O |
| SMILES: | O=C1N(CC#CC[N+](C)(C)C)CCC1.[I-] |
| Purity: | 98.0 |
| Description: | Oxotremorine M iodide is a potent and non-selective muscarinic acetylcholine receptor (mAChR) agonist. Oxotremorine M iodide potentiates NMDA receptors by muscarinic receptor dependent and independent mechanisms[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
