Barasertib-HQPA [CAS 722544-51-6]
Partner: MedChemexpress LLC
| CAS No: | 722544-51-6 |
| Applications: | Cancer-Kinase/protease |
| MW: | 507.56 |
| Formula: | C26H30FN7O3 |
| SMILES: | O=C(CC1=NNC(NC2=C3C=CC(OCCCN(CCO)CC)=CC3=NC=N2)=C1)NC4=CC=CC(F)=C4 |
| Purity: | 99.47 |
| Description: | Barasertib-HQPA (AZD2811) is a highly selective Aurora B inhibitor with an IC50 of 0.37 nM in a cell-free assay. Barasertib-HQPA (AZD2811) induces growth arrest and apoptosis in cancer cells[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
