(2R,5S)-Ritlecitinib [CAS 1792180-79-0]
Partner: MedChemexpress LLC
| CAS No: | 1792180-79-0 |
| Applications: | COVID-19-immunoregulation |
| MW: | 285.34 |
| Formula: | C15H19N5O |
| SMILES: | C[C@@H]1CC[C@@H](CN1C(C=C)=O)NC2=C3C=CNC3=NC=N2 |
| Purity: | 98.83 |
| Description: | (2R,5S)-Ritlecitinib ((2R,5S)-PF-06651600) is a potent and selective JAK3 inhibitor (IC50=144.8 nM) extracted from patent US20150158864A1, example 68[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
