AS1842856 [CAS 836620-48-5]
Partner: MedChemexpress LLC
| CAS No: | 836620-48-5 |
| Applications: | Metabolism-sugar/lipid metabolism |
| MW: | 347.38 |
| Formula: | C18H22FN3O3 |
| SMILES: | O=C(C1=CN(CC)C2=C(C(N)=C(F)C(NC3CCCCC3)=C2)C1=O)O |
| Purity: | 99.83 |
| Description: | AS1842856, a specific Foxo1 inhibitor (IC50=30 nM), potently suppresses autophagy[1]. AS1842856 only reduces the activity of FoxO1 by binding with it, without affecting its transcription and protein expression[2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
