ML162 [CAS 1035072-16-2]
Partner: MedChemexpress LLC
| CAS No: | 1035072-16-2 |
| Applications: | Cancer-programmed cell death |
| MW: | 477.40 |
| Formula: | C23H22Cl2N2O3S |
| SMILES: | O=C(CCl)N(C(C1=CC=CS1)C(NCCC2=CC=CC=C2)=O)C3=CC=C(OC)C(Cl)=C3 |
| Purity: | 99.52 |
| Description: | ML162 is a covalent glutathione peroxidase 4 (GPX4) inhibitor. ML162 has a selective lethal effect on mutant RAS oncogene-expressing cell lines[1][2] |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
