Dexamethasone-biotin [CAS 85679-56-7]
Partner: Toronto Research Chemicals
| CAS No: | 85679-56-7 |
| MW: | 688.89 |
| Formula: | C??H??FN?O?S |
| SMILES: | O=C1C=C[C@@]2(C)C(CC[C@]3([H])[C@]2(F)[C@@H](O)C[C@@]4(C)[C@@]3([H])C[C@@H](C)[C@@]4(C(NCCCCCNC(CCCC[C@@H]5SC[C@@]6([H])[C@]5([H])NC(N6)=O)=O)=O)O)=C1 |
| Description: | Appearance: White to Light Brown Solid |
| Further Information: | Solubility: DMSO (Slightly), Methanol (Slightly) |
| Shipping Conditions: | Ship at ambient |
| Storage: | -20 C, Hygroscopic |
| Usage: | Research use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
