3�-[4-(5-Chloro-2,3-dihydro-2-oxo-1H-benzimidazol-1-yl)-1-piperidinyl]propyl Domperidine (Domperidine Impurity F) [CAS 1391053-55-6]
Partner: Toronto Research Chemicals
| CAS No: | 1391053-55-6 |
| MW: | 717.69 |
| Formula: | C??H??Cl?N?O? |
| SMILES: | C1CN(CCC1N2C3=C(C=C(C=C3)Cl)NC2=O)CCCN4C5=CC=CC=C5N(C4=O)CCCN6CCC(CC6)N7C8=C(C=C(C=C8)Cl)NC7=O |
| Description: | Appearance: White to Off-White Solid |
| Further Information: | Solubility: DMSO (Slightly), Methanol (Slightly) |
| Shipping Conditions: | Ship at ambient |
| Storage: | -20 C, Inert atmosphere |
| Usage: | Research use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
