Fluorescein Bis(methylene)]bis[N-(carboxymethyl)glycine] Sodium Salt (Technical Grade)
Partner: Toronto Research Chemicals
| MW: | 622.53 + x(22.99) |
| Formula: | C??H??N?O?? - xNa |
| SMILES: | OC1=C(CN(CC(O)=O)CC(O)=O)C2=C(C=C1)C3(C(C=CC=C4)=C4C(O3)=O)C5=CC=C(O)C(CN(CC(O)=O)CC(O)=O)=C5O2 |
| Description: | Appearance: Yellow to Dark Yellow Solid |
| Further Information: | Solubility: DMSO (Slightly, Heated), Methanol (Slightly, Heated, Sonicated) |
| Shipping Conditions: | Ship at ambient |
| Storage: | 20 C, Hygroscopic |
| Usage: | Research use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
