Moxidectin [CAS 113507-06-5] (10mM in DMSO)
Partner: MedChemexpress LLC
| CAS No: | 113507-06-5 |
| Applications: | COVID-19-immunoregulation |
| MW: | 639.82 |
| Formula: | C37H53NO8 |
| SMILES: | C/C([C@H]([C@H](/C1=N/OC)C)O[C@]2(C1)C[C@](OC([C@@](C=C(C)[C@@H](O)[C@@]3([H])OC/C4=C\C=C\[C@H](C)C5)([H])[C@@]34O)=O)([H])C[C@](C/C=C5\C)([H])O2)=C\C(C)C |
| Purity: | 98.03 |
| Description: | Moxidectin (ProHeart 6; CL301423; Cydectin) is an anthelmintic used to prevent and control heartworms and roundworms. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
