MMV009085 [CAS 298217-59-1]
Partner: MedChemexpress LLC
| CAS No: | 298217-59-1 |
| MW: | 410.42 |
| Formula: | C22H22N2O6 |
| SMILES: | O=C1C2=CC=C3C(N(CCCCO)C(C4=CC=C(C2=C34)C(N1CCCCO)=O)=O)=O |
| Purity: | 95.0 |
| Description: | MMV009085 is a potent PfHT1 (Plasmodium�falciparum�hexose transporter)-specific inhibitor and a potential anti-malarial agent . MMV009085 is also a human glucose transporter inhibitor, it has high potency in inhibiting both glucose uptake (IC50: 2.6 ?M in glucose uptake assay) and growth of the parasites (EC50: 1.23�0.04 ?M against 3D7)[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
