Taxine (mixture of Taxine B and iso-Taxine B) (~80%)
Partner: Toronto Research Chemicals
| MW: | 583.72 |
| Formula: | C??H??NO? |
| SMILES: | CC1(C)[C@@]2(O)CC(C(C)=C1[C@@H](O)[C@H](OC(C)=O)[C@@]3(C)[C@@]([H])(C([C@@H](OC(C[C@@H](N(C)C)C4=CC=CC=C4)=O)CC3)=C)[C@@H]2O)=O.CC5(C)[C@@]6(O)CC(C(C)=C5[C@@H](OC(C)=O)[C@H](O)[C@@]7(C)[C@@]([H])(C([C@@H](OC(C[C@@H](N(C)C)C8=CC=CC=C8)=O)CC7)=C)[C@@H]6O)=O |
| Description: | Appearance: White to Off-White Solid |
| Further Information: | Solubility: Acetone (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| Shipping Conditions: | Ship on cold pack |
| Storage: | -20 C, Hygroscopic |
| Usage: | Research use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
