Deoxycholic Acid-d5 [CAS 52840-14-9]
Partner: Toronto Research Chemicals
| CAS No: | 52840-14-9 |
| MW: | 397.6 |
| Formula: | C24H35D5O4 |
| SMILES: | O[C@]1([2H])C([2H])([2H])C[C@@]2(C)[C@@](CCC3C2C[C@H](O)[C@@]4(C)[C@@]3([H])CC[C@@H]4[C@@H](CCC(O)=O)C)([H])C1([2H])[2H] |
| Description: | Appearance: White and Off-White Solid |
| Further Information: | Solubility: DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| Shipping Conditions: | Ship at ambient |
| Storage: | Refrigerator |
| Usage: | Research use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
