21-Dehydro Betamethasone (mixture of the aldehyde and the hydrated form) [CAS 61558-12-1]
Partner: Toronto Research Chemicals
| CAS No: | 61558-12-1 |
| MW: | 390.45 |
| Formula: | C??H??FO? |
| SMILES: | O=C(C(O)O)[C@]1(O)[C@@]2(C)C[C@H](O)[C@@]3(F)[C@@]([C@]2([H])C[C@@H]1C)([H])CCC4=CC(C=C[C@@]43C)=O.O=C(C=O)[C@]5(O)[C@@]6(C)C[C@H](O)[C@@]7(F)[C@@]([C@]6([H])C[C@@H]5C)([H])CCC8=CC(C=C[C@@]87C)=O |
| Description: | Appearance: Pale Yellow Solid |
| Further Information: | Solubility: DMSO (Slightly), Methanol (Slightly) |
| Shipping Conditions: | Ship at ambient |
| Storage: | -20 C, Hygroscopic |
| Usage: | Research use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
