p-Nitrophenyl-a-D-maltoside [CAS 17400-77-0]
Partner: Toronto Research Chemicals
| CAS No: | 17400-77-0 |
| MW: | 463.39 |
| Formula: | C18H25NO13 |
| SMILES: | O=[N+]([O-])C1=CC=C(O[C@@H]2[C@H](O)[C@@H](O)[C@H](O[C@@H]3[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O3)[C@@H](CO)O2)C=C1 |
| Description: | Appearance: White to Off-White Solid |
| Further Information: | Solubility: DMSO (Slightly), Methanol (Slightly) |
| Shipping Conditions: | Ship at ambient |
| Storage: | Hygroscopic, -20 C Freezer, Under inert atmosphere |
| Usage: | Research use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
