4-Methylumbelliferyl a-L-Iduronide (free acid) [CAS 66966-09-4]
Partner: Toronto Research Chemicals
| CAS No: | 66966-09-4 |
| MW: | 352.29 |
| Formula: | C??H??O? |
| SMILES: | CN([C@]1(CN(C2=O)C3([C@H](C2)C)C4)[C@]4([H])C(C)(C)[C@@](C(N5C)=O)(CC5=O)C1)C3=O |
| Description: | Appearance: White to Off-White Solid |
| Further Information: | Solubility: Acetonitrile (Slightly), Methanol (Slightly), Water (Slightly) |
| Shipping Conditions: | Ship at ambient |
| Storage: | -20 C |
| Usage: | Research use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
