4-Methylumbelliferyl b-D-N,N�,N�-Triacetylchitotrioside [CAS 53643-13-3]
Partner: Toronto Research Chemicals
| CAS No: | 53643-13-3 |
| MW: | 785.75 |
| Formula: | C??H??N?O?? |
| SMILES: | O=C(O1)C=C(C)C2=C1C=C(O[C@H]3[C@H](NC(C)=O)[C@@H](O)[C@H](O[C@H]4[C@H](NC(C)=O)[C@@H](O)[C@H](O)[C@@H](CO)O4)[C@@H](CO)O3)C=C2 |
| Description: | Appearance: White to Pale Yellow Solid |
| Further Information: | Solubility: DMSO (Slightly), Methanol (Very Slightly), Water (Slightly) |
| Shipping Conditions: | Ship at ambient |
| Storage: | -20 C, Hygroscopic |
| Usage: | Research use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
