Triheptanoin [CAS 620-67-7]
Partner: MedChemexpress LLC
| CAS No: | 620-67-7 |
| Applications: | Neuroscience-Neurodegeneration |
| MW: | 428.61 |
| Formula: | C24H44O6 |
| SMILES: | CCCCCCC(OCC(OC(CCCCCC)=O)COC(CCCCCC)=O)=O |
| Purity: | 99.69 |
| Description: | Triheptanoin (Propane-1,2,3-triyl triheptanoate) is a synthetic medium-chain triglyceride (MCT) consisting of three odd-chain 7-carbon (heptanoate) fatty acids on a glycerol backbone. Triheptanoin can be used for the research of inherited metabolic disorders[1]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
