Ecopladib [CAS 381683-92-7]
Partner: MedChemexpress LLC
| CAS No: | 381683-92-7 |
| Applications: | COVID-19-immunoregulation |
| MW: | 748.11 |
| Formula: | C39H33Cl3N2O5S |
| SMILES: | O=C(O)C1=CC=C(OCCC2=C(CCNS(=O)(CC3=CC=C(Cl)C(Cl)=C3)=O)N(C(C4=CC=CC=C4)C5=CC=CC=C5)C6=C2C=C(Cl)C=C6)C=C1 |
| Purity: | 95.0 |
| Description: | Ecopladib is a sub-micromolar inhibitor of cytosolic phospholipase A2? (cPLA2?), with IC50s of 0.15 ?M and 0.11 ?M in the GLU micelle and rat whole blood assays, respectively. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
