[Glp1]-FGL peptide (acetate)
Partner: MedChemexpress LLC
| Applications: | Neuroscience-Neuromodulation |
| MW: | 1691.83 |
| Formula: | C73H118N20O26 |
| SMILES: | O=C(N[C@@H](C(C)C)C(N[C@@H](CC1=CC=C(C=C1)O)C(N[C@@H](C(C)C)C(N[C@@H](C(C)C)C(N[C@@H](C)C(N[C@@H](CCC(O)=O)C(N[C@@H](CC(N)=O)C(N[C@@H](CCC(N)=O)C(N[C@@H](CCC(N)=O)C(NCC(N[C@@H](CCCCN)C(N[C@@H](CO)C(N[C@@H](CCCCN)C(N[C@@H](C)C(O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](CCC(O)=O)N.CC(O)=O |
| Purity: | 99.86 |
| Description: | [Glp1]-FGL peptide acetate is a neural cell adhesion molecule (NCAM) derived motif and can be used for the research of neurogenesis[1]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
