Oxytocin antiparallel dimer [CAS 20054-93-7]
Partner: MedChemexpress LLC
| CAS No: | 20054-93-7 |
| Applications: | Metabolism-protein/nucleotide metabolism |
| MW: | 2014.37 |
| Formula: | C86H132N24O24S4 |
| SMILES: | O=C([C@H]1NC([C@@H](NC([C@@H](NC([C@](NC([C@@H](NC([C@H](CSSC[C@H](NC([C@@H](NC([C@@H](NC([C@](NC([C@@H](NC([C@H](CSSC1)N)=O)CC2=CC=C(C=C2)O)=O)([H])[C@@H](C)CC)=O)CCC(N)=O)=O)CC(N)=O)=O)C(N3[C@@H](CCC3)C(N[C@@H](CC(C)C)C(NCC(N)=O)=O)=O)=O)N)=O)CC4=CC=C(C=C4)O)=O)([H])[C@@H](C)CC)=O)CCC(N)=O)=O)CC(N)=O)=O)N5[C@@H](CCC5)C(N[C@@H](CC(C)C)C(NCC(N)=O)=O)=O |
| Purity: | 98.26 |
| Description: | Oxytocin antiparallel dimer is the disulfide-bridged homo peptide dimer. Oxytocin dimer has oxytocin and vasopressin-like activity with less toxic than oxytocin[1][2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
